C18H17ClFN3O3 — CID 34082442
1-[2-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]acetyl]imidazolidin-2-one (PubChem CID 34082442) has the molecular formula C18H17ClFN3O3 and a molecular weight of 377.80 g/mol. Its IUPAC name is 1-[2-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]acetyl]imidazolidin-2-one.
| Compound Name | 1-[2-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]acetyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 34082442 |
| Molecular Formula | C18H17ClFN3O3 |
| Molecular Weight | 377.80 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 1-[2-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]acetyl]imidazolidin-2-one |
| SMILES | O=C(CNc1ccc(OCc2cccc(F)c2)c(Cl)c1)N1CCNC1=O |
| InChI | InChI=1S/C18H17ClFN3O3/c19-15-9-14(22-10-17(24)23-7-6-21-18(23)25)4-5-16(15)26-11-12-2-1-3-13(20)8-12/h1-5,8-9,22H,6-7,10-11H2,(H,21,25) |
| InChIKey | JYKZVTMWISYEOD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.80 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|