C14H19ClF3NO2 — CID 116699508
3-chloro-N-(3,3-diethoxypropyl)-5-(trifluoromethyl)aniline (PubChem CID 116699508) has the molecular formula C14H19ClF3NO2 and a molecular weight of 325.76 g/mol. Its IUPAC name is 3-chloro-N-(3,3-diethoxypropyl)-5-(trifluoromethyl)aniline.
| Compound Name | 3-chloro-N-(3,3-diethoxypropyl)-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 116699508 |
| Molecular Formula | C14H19ClF3NO2 |
| Molecular Weight | 325.76 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 3-chloro-N-(3,3-diethoxypropyl)-5-(trifluoromethyl)aniline |
| SMILES | CCOC(CCNc1cc(Cl)cc(C(F)(F)F)c1)OCC |
| InChI | InChI=1S/C14H19ClF3NO2/c1-3-20-13(21-4-2)5-6-19-12-8-10(14(16,17)18)7-11(15)9-12/h7-9,13,19H,3-6H2,1-2H3 |
| InChIKey | OICDASBPQJVGIG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.76 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|