C8H5ClF4O4S — CID 58003841
[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]-hydroxymethanesulfonic acid (PubChem CID 58003841) has the molecular formula C8H5ClF4O4S and a molecular weight of 308.64 g/mol. Its IUPAC name is [3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]-hydroxymethanesulfonic acid.
| Compound Name | [3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]-hydroxymethanesulfonic acid |
|---|---|
| PubChem CID | 58003841 |
| Molecular Formula | C8H5ClF4O4S |
| Molecular Weight | 308.64 g/mol |
| Exact Mass | 307.95 |
| IUPAC Name | [3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]-hydroxymethanesulfonic acid |
| SMILES | O=S(=O)(O)C(O)c1cc(C(F)(F)F)cc(Cl)c1F |
| InChI | InChI=1S/C8H5ClF4O4S/c9-5-2-3(8(11,12)13)1-4(6(5)10)7(14)18(15,16)17/h1-2,7,14H,(H,15,16,17) |
| InChIKey | WSIYZVDKOIYXAI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.64 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|