C10H4Cl2F3N3O2 — CID 19778331
2-[2,6-dichloro-4-(trifluoromethoxy)phenyl]triazole-4-carbaldehyde (PubChem CID 19778331) has the molecular formula C10H4Cl2F3N3O2 and a molecular weight of 326.06 g/mol. Its IUPAC name is 2-[2,6-dichloro-4-(trifluoromethoxy)phenyl]triazole-4-carbaldehyde.
| Compound Name | 2-[2,6-dichloro-4-(trifluoromethoxy)phenyl]triazole-4-carbaldehyde |
|---|---|
| PubChem CID | 19778331 |
| Molecular Formula | C10H4Cl2F3N3O2 |
| Molecular Weight | 326.06 g/mol |
| Exact Mass | 324.96 |
| IUPAC Name | 2-[2,6-dichloro-4-(trifluoromethoxy)phenyl]triazole-4-carbaldehyde |
| SMILES | O=Cc1cnn(-c2c(Cl)cc(OC(F)(F)F)cc2Cl)n1 |
| InChI | InChI=1S/C10H4Cl2F3N3O2/c11-7-1-6(20-10(13,14)15)2-8(12)9(7)18-16-3-5(4-19)17-18/h1-4H |
| InChIKey | AHJDOJOPEGUWRT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.06 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|