C13H11Cl2F3N4O2S2 — CID 139887151
4-(1-aminoethylsulfinyl)-1-[2,6-dichloro-4-(trifluoromethoxy)phenyl]pyrazole-3-carbothioamide (PubChem CID 139887151) has the molecular formula C13H11Cl2F3N4O2S2 and a molecular weight of 447.29 g/mol. Its IUPAC name is 4-(1-aminoethylsulfinyl)-1-[2,6-dichloro-4-(trifluoromethoxy)phenyl]pyrazole-3-carbothioamide.
| Compound Name | 4-(1-aminoethylsulfinyl)-1-[2,6-dichloro-4-(trifluoromethoxy)phenyl]pyrazole-3-carbothioamide |
|---|---|
| PubChem CID | 139887151 |
| Molecular Formula | C13H11Cl2F3N4O2S2 |
| Molecular Weight | 447.29 g/mol |
| Exact Mass | 445.97 |
| IUPAC Name | 4-(1-aminoethylsulfinyl)-1-[2,6-dichloro-4-(trifluoromethoxy)phenyl]pyrazole-3-carbothioamide |
| SMILES | CC(N)S(=O)c1cn(-c2c(Cl)cc(OC(F)(F)F)cc2Cl)nc1C(N)=S |
| InChI | InChI=1S/C13H11Cl2F3N4O2S2/c1-5(19)26(23)9-4-22(21-10(9)12(20)25)11-7(14)2-6(3-8(11)15)24-13(16,17)18/h2-5H,19H2,1H3,(H2,20,25) |
| InChIKey | NITQQTZCDXIJFN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|