C12H6Cl4F4N2O2S — CID 19754631
4-[dichloro(fluoro)methyl]sulfinyl-1-[2,6-dichloro-4-(trifluoromethoxy)phenyl]-2-methylimidazole (PubChem CID 19754631) has the molecular formula C12H6Cl4F4N2O2S and a molecular weight of 460.06 g/mol. Its IUPAC name is 4-[dichloro(fluoro)methyl]sulfinyl-1-[2,6-dichloro-4-(trifluoromethoxy)phenyl]-2-methylimidazole.
| Compound Name | 4-[dichloro(fluoro)methyl]sulfinyl-1-[2,6-dichloro-4-(trifluoromethoxy)phenyl]-2-methylimidazole |
|---|---|
| PubChem CID | 19754631 |
| Molecular Formula | C12H6Cl4F4N2O2S |
| Molecular Weight | 460.06 g/mol |
| Exact Mass | 457.88 |
| IUPAC Name | 4-[dichloro(fluoro)methyl]sulfinyl-1-[2,6-dichloro-4-(trifluoromethoxy)phenyl]-2-methylimidazole |
| SMILES | Cc1nc(S(=O)C(F)(Cl)Cl)cn1-c1c(Cl)cc(OC(F)(F)F)cc1Cl |
| InChI | InChI=1S/C12H6Cl4F4N2O2S/c1-5-21-9(25(23)11(15,16)17)4-22(5)10-7(13)2-6(3-8(10)14)24-12(18,19)20/h2-4H,1H3 |
| InChIKey | ZADHVSLOHMBPRL-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.06 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|