About 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-ethenyl-3,5-dimethylpyrazole
1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-ethenyl-3,5-dimethylpyrazole (PubChem CID 21188130) has the molecular formula C14H11Cl2F3N2
and a molecular weight of 335.16 g/mol. Its IUPAC name is 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-ethenyl-3,5-dimethylpyrazole.
Molecular Properties
| Compound Name | 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-ethenyl-3,5-dimethylpyrazole |
| PubChem CID | 21188130 |
| Molecular Formula | C14H11Cl2F3N2 |
| Molecular Weight | 335.16 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-ethenyl-3,5-dimethylpyrazole |
| SMILES | C=Cc1c(C)nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c1C |
| InChI | InChI=1S/C14H11Cl2F3N2/c1-4-10-7(2)20-21(8(10)3)13-11(15)5-9(6-12(13)16)14(17,18)19/h4-6H,1H2,2-3H3 |
| InChIKey | AZUWBBIVRZFIQG-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.16 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-ethenyl-3,5-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-ethenyl-3,5-dimethylpyrazole?
The IUPAC name of 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-ethenyl-3,5-dimethylpyrazole (CID 21188130) is 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-ethenyl-3,5-dimethylpyrazole.
What is the SMILES notation for 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-ethenyl-3,5-dimethylpyrazole?
The canonical SMILES for 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-ethenyl-3,5-dimethylpyrazole is C=Cc1c(C)nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c1C.
What is the InChIKey of 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-ethenyl-3,5-dimethylpyrazole?
The InChIKey is AZUWBBIVRZFIQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11Cl2F3N2/c1-4-10-7(2)20-21(8(10)3)13-11(15)5-9(6-12(13)16)14(17,18)19/h4-6H,1H2,2-3H3.
What are the key properties of 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-ethenyl-3,5-dimethylpyrazole?
1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-ethenyl-3,5-dimethylpyrazole has a molecular weight of 335.16 g/mol, XLogP of 5.46, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-ethenyl-3,5-dimethylpyrazole is sourced from PubChem (CID 21188130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).