C13H5Cl2F6N3O2S — CID 10173769
1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-isocyanato-3-methyl-4-(trifluoromethylsulfinyl)pyrazole (PubChem CID 10173769) has the molecular formula C13H5Cl2F6N3O2S and a molecular weight of 452.16 g/mol. Its IUPAC name is 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-isocyanato-3-methyl-4-(trifluoromethylsulfinyl)pyrazole.
| Compound Name | 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-isocyanato-3-methyl-4-(trifluoromethylsulfinyl)pyrazole |
|---|---|
| PubChem CID | 10173769 |
| Molecular Formula | C13H5Cl2F6N3O2S |
| Molecular Weight | 452.16 g/mol |
| Exact Mass | 450.94 |
| IUPAC Name | 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-isocyanato-3-methyl-4-(trifluoromethylsulfinyl)pyrazole |
| SMILES | Cc1nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c(N=C=O)c1S(=O)C(F)(F)F |
| InChI | InChI=1S/C13H5Cl2F6N3O2S/c1-5-10(27(26)13(19,20)21)11(22-4-25)24(23-5)9-7(14)2-6(3-8(9)15)12(16,17)18/h2-3H,1H3 |
| InChIKey | OWLOTUMAWIOUAW-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 64.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.16 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|