C26H28Cl2F3N5O11S — CID 74012245
[3,4,5-triacetyloxy-6-[[amino-[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-methylsulfinylpyrazol-3-yl]methylidene]amino]oxyoxan-2-yl]methyl acetate (PubChem CID 74012245) has the molecular formula C26H28Cl2F3N5O11S and a molecular weight of 746.50 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[[amino-[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-methylsulfinylpyrazol-3-yl]methylidene]amino]oxyoxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-[[amino-[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-methylsulfinylpyrazol-3-yl]methylidene]amino]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 74012245 |
| Molecular Formula | C26H28Cl2F3N5O11S |
| Molecular Weight | 746.50 g/mol |
| Exact Mass | 745.08 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[[amino-[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-methylsulfinylpyrazol-3-yl]methylidene]amino]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(ON=C(N)c2nn(-c3c(Cl)cc(C(F)(F)F)cc3Cl)c(N)c2S(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C26H28Cl2F3N5O11S/c1-9(37)42-8-16-19(43-10(2)38)20(44-11(3)39)21(45-12(4)40)25(46-16)47-35-23(32)17-22(48(5)41)24(33)36(34-17)18-14(27)6-13(7-15(18)28)26(29,30)31/h6-7,16,19-21,25H,8,33H2,1-5H3,(H2,32,35) |
| InChIKey | HCBMILOEIFFVBZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 222.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|