C12H9BrClF3N4OS2 — CID 10298328
5-amino-1-[2-bromo-6-chloro-4-(trifluoromethyl)phenyl]-4-methylsulfinylpyrazole-3-carbothioamide (PubChem CID 10298328) has the molecular formula C12H9BrClF3N4OS2 and a molecular weight of 461.72 g/mol. Its IUPAC name is 5-amino-1-[2-bromo-6-chloro-4-(trifluoromethyl)phenyl]-4-methylsulfinylpyrazole-3-carbothioamide.
| Compound Name | 5-amino-1-[2-bromo-6-chloro-4-(trifluoromethyl)phenyl]-4-methylsulfinylpyrazole-3-carbothioamide |
|---|---|
| PubChem CID | 10298328 |
| Molecular Formula | C12H9BrClF3N4OS2 |
| Molecular Weight | 461.72 g/mol |
| Exact Mass | 459.90 |
| IUPAC Name | 5-amino-1-[2-bromo-6-chloro-4-(trifluoromethyl)phenyl]-4-methylsulfinylpyrazole-3-carbothioamide |
| SMILES | CS(=O)c1c(C(N)=S)nn(-c2c(Cl)cc(C(F)(F)F)cc2Br)c1N |
| InChI | InChI=1S/C12H9BrClF3N4OS2/c1-24(22)9-7(11(19)23)20-21(10(9)18)8-5(13)2-4(3-6(8)14)12(15,16)17/h2-3H,18H2,1H3,(H2,19,23) |
| InChIKey | CICWDLGVJKMEIX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.72 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|