C17H19Cl2F3N6O2S — CID 70032996
N-[[amino-[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-methylsulfinylpyrazol-3-yl]methylidene]amino]-2,2-dimethylpropanamide (PubChem CID 70032996) has the molecular formula C17H19Cl2F3N6O2S and a molecular weight of 499.35 g/mol. Its IUPAC name is N-[[amino-[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-methylsulfinylpyrazol-3-yl]methylidene]amino]-2,2-dimethylpropanamide.
| Compound Name | N-[[amino-[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-methylsulfinylpyrazol-3-yl]methylidene]amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 70032996 |
| Molecular Formula | C17H19Cl2F3N6O2S |
| Molecular Weight | 499.35 g/mol |
| Exact Mass | 498.06 |
| IUPAC Name | N-[[amino-[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-methylsulfinylpyrazol-3-yl]methylidene]amino]-2,2-dimethylpropanamide |
| SMILES | CS(=O)c1c(C(N)=NNC(=O)C(C)(C)C)nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c1N |
| InChI | InChI=1S/C17H19Cl2F3N6O2S/c1-16(2,3)15(29)26-25-13(23)10-12(31(4)30)14(24)28(27-10)11-8(18)5-7(6-9(11)19)17(20,21)22/h5-6H,24H2,1-4H3,(H2,23,25)(H,26,29) |
| InChIKey | WMIPSHRZDQFNPM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 128.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|