C12H9Cl2F3N4O3S2 — CID 174397420
[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-[formyl(sulfanyl)amino]pyrazol-4-yl]methanesulfinic acid (PubChem CID 174397420) has the molecular formula C12H9Cl2F3N4O3S2 and a molecular weight of 449.26 g/mol. Its IUPAC name is [5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-[formyl(sulfanyl)amino]pyrazol-4-yl]methanesulfinic acid.
| Compound Name | [5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-[formyl(sulfanyl)amino]pyrazol-4-yl]methanesulfinic acid |
|---|---|
| PubChem CID | 174397420 |
| Molecular Formula | C12H9Cl2F3N4O3S2 |
| Molecular Weight | 449.26 g/mol |
| Exact Mass | 447.94 |
| IUPAC Name | [5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-[formyl(sulfanyl)amino]pyrazol-4-yl]methanesulfinic acid |
| SMILES | Nc1c(CS(=O)O)c(N(S)C=O)nn1-c1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C12H9Cl2F3N4O3S2/c13-7-1-5(12(15,16)17)2-8(14)9(7)21-10(18)6(3-26(23)24)11(19-21)20(25)4-22/h1-2,4,25H,3,18H2,(H,23,24) |
| InChIKey | CDIUNCDBIYEUHF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.26 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|