C14H7ClF3N3O3 — CID 139617802
[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]indazol-6-yl] hydrogen carbonate (PubChem CID 139617802) has the molecular formula C14H7ClF3N3O3 and a molecular weight of 357.68 g/mol. Its IUPAC name is [1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]indazol-6-yl] hydrogen carbonate.
| Compound Name | [1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]indazol-6-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 139617802 |
| Molecular Formula | C14H7ClF3N3O3 |
| Molecular Weight | 357.68 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | [1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]indazol-6-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1ccc2cnn(-c3ncc(C(F)(F)F)cc3Cl)c2c1 |
| InChI | InChI=1S/C14H7ClF3N3O3/c15-10-3-8(14(16,17)18)6-19-12(10)21-11-4-9(24-13(22)23)2-1-7(11)5-20-21/h1-6H,(H,22,23) |
| InChIKey | IHQYKOUBCKMMJJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.68 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|