C21H25ClF3N2O6P — CID 54288670
2-amino-4-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]-2-diethoxyphosphorylpentan-3-one (PubChem CID 54288670) has the molecular formula C21H25ClF3N2O6P and a molecular weight of 524.86 g/mol. Its IUPAC name is 2-amino-4-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]-2-diethoxyphosphorylpentan-3-one.
| Compound Name | 2-amino-4-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]-2-diethoxyphosphorylpentan-3-one |
|---|---|
| PubChem CID | 54288670 |
| Molecular Formula | C21H25ClF3N2O6P |
| Molecular Weight | 524.86 g/mol |
| Exact Mass | 524.11 |
| IUPAC Name | 2-amino-4-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]-2-diethoxyphosphorylpentan-3-one |
| SMILES | CCOP(=O)(OCC)C(C)(N)C(=O)C(C)Oc1ccc(Oc2ncc(C(F)(F)F)cc2Cl)cc1 |
| InChI | InChI=1S/C21H25ClF3N2O6P/c1-5-30-34(29,31-6-2)20(4,26)18(28)13(3)32-15-7-9-16(10-8-15)33-19-17(22)11-14(12-27-19)21(23,24)25/h7-13H,5-6,26H2,1-4H3 |
| InChIKey | RVYQJZPGOCEQRV-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 109.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.86 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|