C30H26Br2ClF6N2O5P — CID 162114595
2-[3-bromo-5-(chloromethyl)phenoxy]-5-(trifluoromethyl)pyridine;2-[3-bromo-5-(diethoxyphosphorylmethyl)phenoxy]-5-(trifluoromethyl)pyridine (PubChem CID 162114595) has the molecular formula C30H26Br2ClF6N2O5P and a molecular weight of 834.77 g/mol. Its IUPAC name is 2-[3-bromo-5-(chloromethyl)phenoxy]-5-(trifluoromethyl)pyridine;2-[3-bromo-5-(diethoxyphosphorylmethyl)phenoxy]-5-(trifluoromethyl)pyridine.
| Compound Name | 2-[3-bromo-5-(chloromethyl)phenoxy]-5-(trifluoromethyl)pyridine;2-[3-bromo-5-(diethoxyphosphorylmethyl)phenoxy]-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 162114595 |
| Molecular Formula | C30H26Br2ClF6N2O5P |
| Molecular Weight | 834.77 g/mol |
| Exact Mass | 831.95 |
| IUPAC Name | 2-[3-bromo-5-(chloromethyl)phenoxy]-5-(trifluoromethyl)pyridine;2-[3-bromo-5-(diethoxyphosphorylmethyl)phenoxy]-5-(trifluoromethyl)pyridine |
| SMILES | CCOP(=O)(Cc1cc(Br)cc(Oc2ccc(C(F)(F)F)cn2)c1)OCC.FC(F)(F)c1ccc(Oc2cc(Br)cc(CCl)c2)nc1 |
| InChI | InChI=1S/C17H18BrF3NO4P.C13H8BrClF3NO/c1-3-24-27(23,25-4-2)11-12-7-14(18)9-15(8-12)26-16-6-5-13(10-22-16)17(19,20)21;14-10-3-8(6-15)4-11(5-10)20-12-2-1-9(7-19-12)13(16,17)18/h5-10H,3-4,11H2,1-2H3;1-5,7H,6H2 |
| InChIKey | ZGPGELRTERBGQU-UHFFFAOYSA-N |
| XLogP | 11.82 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.77 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|