C21H12Cl2F3N3O6 — CID 58737181
methyl 2-[(2-chloro-5-nitrobenzoyl)amino]-5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]benzoate (PubChem CID 58737181) has the molecular formula C21H12Cl2F3N3O6 and a molecular weight of 530.24 g/mol. Its IUPAC name is methyl 2-[(2-chloro-5-nitrobenzoyl)amino]-5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]benzoate.
| Compound Name | methyl 2-[(2-chloro-5-nitrobenzoyl)amino]-5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]benzoate |
|---|---|
| PubChem CID | 58737181 |
| Molecular Formula | C21H12Cl2F3N3O6 |
| Molecular Weight | 530.24 g/mol |
| Exact Mass | 529.01 |
| IUPAC Name | methyl 2-[(2-chloro-5-nitrobenzoyl)amino]-5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]benzoate |
| SMILES | COC(=O)c1cc(Oc2ncc(C(F)(F)F)cc2Cl)ccc1NC(=O)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C21H12Cl2F3N3O6/c1-34-20(31)14-8-12(35-19-16(23)6-10(9-27-19)21(24,25)26)3-5-17(14)28-18(30)13-7-11(29(32)33)2-4-15(13)22/h2-9H,1H3,(H,28,30) |
| InChIKey | SUJVRWYQQHIIJO-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.24 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|