C19H9Cl2F3N4O6 — CID 58737129
2-chloro-N-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-3-nitrophenyl]-5-nitrobenzamide (PubChem CID 58737129) has the molecular formula C19H9Cl2F3N4O6 and a molecular weight of 517.20 g/mol. Its IUPAC name is 2-chloro-N-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-3-nitrophenyl]-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-3-nitrophenyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 58737129 |
| Molecular Formula | C19H9Cl2F3N4O6 |
| Molecular Weight | 517.20 g/mol |
| Exact Mass | 515.99 |
| IUPAC Name | 2-chloro-N-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-3-nitrophenyl]-5-nitrobenzamide |
| SMILES | O=C(Nc1ccc(Oc2ncc(C(F)(F)F)cc2Cl)c([N+](=O)[O-])c1)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C19H9Cl2F3N4O6/c20-13-3-2-11(27(30)31)7-12(13)17(29)26-10-1-4-16(15(6-10)28(32)33)34-18-14(21)5-9(8-25-18)19(22,23)24/h1-8H,(H,26,29) |
| InChIKey | YZIRAIZXTPLBRQ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 137.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.20 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|