C22H15Cl2F3N4O3 — CID 176884634
2-chloro-N-[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-3,4-dihydro-2H-quinolin-6-yl]-5-nitrobenzamide (PubChem CID 176884634) has the molecular formula C22H15Cl2F3N4O3 and a molecular weight of 511.29 g/mol. Its IUPAC name is 2-chloro-N-[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-3,4-dihydro-2H-quinolin-6-yl]-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-3,4-dihydro-2H-quinolin-6-yl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 176884634 |
| Molecular Formula | C22H15Cl2F3N4O3 |
| Molecular Weight | 511.29 g/mol |
| Exact Mass | 510.05 |
| IUPAC Name | 2-chloro-N-[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-3,4-dihydro-2H-quinolin-6-yl]-5-nitrobenzamide |
| SMILES | O=C(Nc1ccc2c(c1)CCCN2c1ncc(C(F)(F)F)cc1Cl)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C22H15Cl2F3N4O3/c23-17-5-4-15(31(33)34)10-16(17)21(32)29-14-3-6-19-12(8-14)2-1-7-30(19)20-18(24)9-13(11-28-20)22(25,26)27/h3-6,8-11H,1-2,7H2,(H,29,32) |
| InChIKey | GKXQYEQVEZUCST-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.29 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|