C19H8Cl3F4N3O4 — CID 58737126
N-[3,5-dichloro-4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]-2-fluoro-5-nitrobenzamide (PubChem CID 58737126) has the molecular formula C19H8Cl3F4N3O4 and a molecular weight of 524.64 g/mol. Its IUPAC name is N-[3,5-dichloro-4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]-2-fluoro-5-nitrobenzamide.
| Compound Name | N-[3,5-dichloro-4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]-2-fluoro-5-nitrobenzamide |
|---|---|
| PubChem CID | 58737126 |
| Molecular Formula | C19H8Cl3F4N3O4 |
| Molecular Weight | 524.64 g/mol |
| Exact Mass | 522.95 |
| IUPAC Name | N-[3,5-dichloro-4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]-2-fluoro-5-nitrobenzamide |
| SMILES | O=C(Nc1cc(Cl)c(Oc2ncc(C(F)(F)F)cc2Cl)c(Cl)c1)c1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C19H8Cl3F4N3O4/c20-12-4-9(28-17(30)11-6-10(29(31)32)1-2-15(11)23)5-13(21)16(12)33-18-14(22)3-8(7-27-18)19(24,25)26/h1-7H,(H,28,30) |
| InChIKey | BIWNSXAPUCOVMQ-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.64 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|