C18H17ClFNO6S — CID 54054161
(2-ethoxy-2-oxoethyl)sulfanyl 2-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenoxy]propanoate (PubChem CID 54054161) has the molecular formula C18H17ClFNO6S and a molecular weight of 429.85 g/mol. Its IUPAC name is (2-ethoxy-2-oxoethyl)sulfanyl 2-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenoxy]propanoate.
| Compound Name | (2-ethoxy-2-oxoethyl)sulfanyl 2-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenoxy]propanoate |
|---|---|
| PubChem CID | 54054161 |
| Molecular Formula | C18H17ClFNO6S |
| Molecular Weight | 429.85 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | (2-ethoxy-2-oxoethyl)sulfanyl 2-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenoxy]propanoate |
| SMILES | CCOC(=O)CSOC(=O)C(C)Oc1ccc(Oc2ncc(Cl)cc2F)cc1 |
| InChI | InChI=1S/C18H17ClFNO6S/c1-3-24-16(22)10-28-27-18(23)11(2)25-13-4-6-14(7-5-13)26-17-15(20)8-12(19)9-21-17/h4-9,11H,3,10H2,1-2H3 |
| InChIKey | LVBCTABQUIZCBA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.85 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|