C20H12Cl2F4O4 — CID 19978816
2-[6-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoic acid (PubChem CID 19978816) has the molecular formula C20H12Cl2F4O4 and a molecular weight of 463.21 g/mol. Its IUPAC name is 2-[6-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoic acid.
| Compound Name | 2-[6-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoic acid |
|---|---|
| PubChem CID | 19978816 |
| Molecular Formula | C20H12Cl2F4O4 |
| Molecular Weight | 463.21 g/mol |
| Exact Mass | 462.00 |
| IUPAC Name | 2-[6-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoic acid |
| SMILES | CC(Oc1ccc2cc(Oc3c(Cl)cc(C(F)(F)F)c(F)c3Cl)ccc2c1)C(=O)O |
| InChI | InChI=1S/C20H12Cl2F4O4/c1-9(19(27)28)29-12-4-2-11-7-13(5-3-10(11)6-12)30-18-15(21)8-14(20(24,25)26)17(23)16(18)22/h2-9H,1H3,(H,27,28) |
| InChIKey | KFWBIECTHBLSIL-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.21 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|