About 3-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-N',N'-dimethyl-2-nitrobenzohydrazide
3-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-N',N'-dimethyl-2-nitrobenzohydrazide (PubChem CID 67920247) has the molecular formula C16H12F5N3O4
and a molecular weight of 405.28 g/mol. Its IUPAC name is 3-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-N',N'-dimethyl-2-nitrobenzohydrazide.
Molecular Properties
| Compound Name | 3-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-N',N'-dimethyl-2-nitrobenzohydrazide |
| PubChem CID | 67920247 |
| Molecular Formula | C16H12F5N3O4 |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | 3-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-N',N'-dimethyl-2-nitrobenzohydrazide |
| SMILES | CN(C)NC(=O)c1cccc(Oc2c(F)cc(C(F)(F)F)cc2F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H12F5N3O4/c1-23(2)22-15(25)9-4-3-5-12(13(9)24(26)27)28-14-10(17)6-8(7-11(14)18)16(19,20)21/h3-7H,1-2H3,(H,22,25) |
| InChIKey | YGAFWFCXHOXLAY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-N',N'-dimethyl-2-nitrobenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-N',N'-dimethyl-2-nitrobenzohydrazide?
The IUPAC name of 3-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-N',N'-dimethyl-2-nitrobenzohydrazide (CID 67920247) is 3-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-N',N'-dimethyl-2-nitrobenzohydrazide.
What is the SMILES notation for 3-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-N',N'-dimethyl-2-nitrobenzohydrazide?
The canonical SMILES for 3-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-N',N'-dimethyl-2-nitrobenzohydrazide is CN(C)NC(=O)c1cccc(Oc2c(F)cc(C(F)(F)F)cc2F)c1[N+](=O)[O-].
What is the InChIKey of 3-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-N',N'-dimethyl-2-nitrobenzohydrazide?
The InChIKey is YGAFWFCXHOXLAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12F5N3O4/c1-23(2)22-15(25)9-4-3-5-12(13(9)24(26)27)28-14-10(17)6-8(7-11(14)18)16(19,20)21/h3-7H,1-2H3,(H,22,25).
What are the key properties of 3-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-N',N'-dimethyl-2-nitrobenzohydrazide?
3-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-N',N'-dimethyl-2-nitrobenzohydrazide has a molecular weight of 405.28 g/mol, XLogP of 3.89, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-N',N'-dimethyl-2-nitrobenzohydrazide is sourced from PubChem (CID 67920247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).