C14H7ClF3NNaO5 — CID 162325333
CID 162325333 (PubChem CID 162325333) has the molecular formula C14H7ClF3NNaO5 and a molecular weight of 384.65 g/mol.
| Compound Name | CID 162325333 |
|---|---|
| PubChem CID | 162325333 |
| Molecular Formula | C14H7ClF3NNaO5 |
| Molecular Weight | 384.65 g/mol |
| Exact Mass | 383.99 |
| IUPAC Name | — |
| SMILES | O=C(O)c1cccc(Oc2ccc(C(F)(F)F)cc2Cl)c1[N+](=O)[O-].[Na] |
| InChI | InChI=1S/C14H7ClF3NO5.Na/c15-9-6-7(14(16,17)18)4-5-10(9)24-11-3-1-2-8(13(20)21)12(11)19(22)23;/h1-6H,(H,20,21); |
| InChIKey | RZGBUVOAAJIHGO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.65 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|