C17H15ClF3N2O7S- — CID 154478342
N-[[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]methoxy]-N-propan-2-ylsulfamate (PubChem CID 154478342) has the molecular formula C17H15ClF3N2O7S- and a molecular weight of 483.83 g/mol. Its IUPAC name is N-[[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]methoxy]-N-propan-2-ylsulfamate.
| Compound Name | N-[[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]methoxy]-N-propan-2-ylsulfamate |
|---|---|
| PubChem CID | 154478342 |
| Molecular Formula | C17H15ClF3N2O7S- |
| Molecular Weight | 483.83 g/mol |
| Exact Mass | 483.02 |
| IUPAC Name | N-[[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]methoxy]-N-propan-2-ylsulfamate |
| SMILES | CC(C)N(OCc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-])S(=O)(=O)[O-] |
| InChI | InChI=1S/C17H16ClF3N2O7S/c1-10(2)23(31(26,27)28)29-9-11-7-13(4-5-15(11)22(24)25)30-16-6-3-12(8-14(16)18)17(19,20)21/h3-8,10H,9H2,1-2H3,(H,26,27,28)/p-1 |
| InChIKey | PWVWUBFPMVTBPJ-UHFFFAOYSA-M |
| XLogP | 4.66 |
| TPSA | 122.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.83 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|