C20H13ClF3N3O7S2 — CID 13472667
N-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]sulfanyl-N-methyl-3-nitrobenzenesulfonamide (PubChem CID 13472667) has the molecular formula C20H13ClF3N3O7S2 and a molecular weight of 563.92 g/mol. Its IUPAC name is N-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]sulfanyl-N-methyl-3-nitrobenzenesulfonamide.
| Compound Name | N-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]sulfanyl-N-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 13472667 |
| Molecular Formula | C20H13ClF3N3O7S2 |
| Molecular Weight | 563.92 g/mol |
| Exact Mass | 562.98 |
| IUPAC Name | N-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]sulfanyl-N-methyl-3-nitrobenzenesulfonamide |
| SMILES | CN(Sc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-])S(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H13ClF3N3O7S2/c1-25(36(32,33)15-4-2-3-13(10-15)26(28)29)35-19-11-14(6-7-17(19)27(30)31)34-18-8-5-12(9-16(18)21)20(22,23)24/h2-11H,1H3 |
| InChIKey | FZDXFNGYGOPKII-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.92 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|