C21H16ClF3N2O6S2 — CID 13472670
N-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]sulfanyl-4-methoxy-N-methylbenzenesulfonamide (PubChem CID 13472670) has the molecular formula C21H16ClF3N2O6S2 and a molecular weight of 548.95 g/mol. Its IUPAC name is N-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]sulfanyl-4-methoxy-N-methylbenzenesulfonamide.
| Compound Name | N-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]sulfanyl-4-methoxy-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 13472670 |
| Molecular Formula | C21H16ClF3N2O6S2 |
| Molecular Weight | 548.95 g/mol |
| Exact Mass | 548.01 |
| IUPAC Name | N-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]sulfanyl-4-methoxy-N-methylbenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)Sc2cc(Oc3ccc(C(F)(F)F)cc3Cl)ccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H16ClF3N2O6S2/c1-26(35(30,31)16-7-4-14(32-2)5-8-16)34-20-12-15(6-9-18(20)27(28)29)33-19-10-3-13(11-17(19)22)21(23,24)25/h3-12H,1-2H3 |
| InChIKey | NWKPFVPRYFQCHU-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.95 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|