C21H23F3NO7P — CID 54331385
[ethyl-[2-nitro-5-[4-(trifluoromethyl)phenoxy]phenyl]phosphoryl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 54331385) has the molecular formula C21H23F3NO7P and a molecular weight of 489.38 g/mol. Its IUPAC name is [ethyl-[2-nitro-5-[4-(trifluoromethyl)phenoxy]phenyl]phosphoryl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [ethyl-[2-nitro-5-[4-(trifluoromethyl)phenoxy]phenyl]phosphoryl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 54331385 |
| Molecular Formula | C21H23F3NO7P |
| Molecular Weight | 489.38 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | [ethyl-[2-nitro-5-[4-(trifluoromethyl)phenoxy]phenyl]phosphoryl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CCP(=O)(OCOC(=O)C(C)(C)C)c1cc(Oc2ccc(C(F)(F)F)cc2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H23F3NO7P/c1-5-33(29,31-13-30-19(26)20(2,3)4)18-12-16(10-11-17(18)25(27)28)32-15-8-6-14(7-9-15)21(22,23)24/h6-12H,5,13H2,1-4H3 |
| InChIKey | SYPFFFRHIOETNL-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.38 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|