C24H16Cl4F3N3O6 — CID 159704256
5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-N-[2-[[2-(2,4,6-trichlorophenoxy)acetyl]amino]ethyl]benzamide (PubChem CID 159704256) has the molecular formula C24H16Cl4F3N3O6 and a molecular weight of 641.21 g/mol. Its IUPAC name is 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-N-[2-[[2-(2,4,6-trichlorophenoxy)acetyl]amino]ethyl]benzamide.
| Compound Name | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-N-[2-[[2-(2,4,6-trichlorophenoxy)acetyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 159704256 |
| Molecular Formula | C24H16Cl4F3N3O6 |
| Molecular Weight | 641.21 g/mol |
| Exact Mass | 638.97 |
| IUPAC Name | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-N-[2-[[2-(2,4,6-trichlorophenoxy)acetyl]amino]ethyl]benzamide |
| SMILES | O=C(COc1c(Cl)cc(Cl)cc1Cl)NCCNC(=O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H16Cl4F3N3O6/c25-13-8-17(27)22(18(28)9-13)39-11-21(35)32-5-6-33-23(36)15-10-14(2-3-19(15)34(37)38)40-20-4-1-12(7-16(20)26)24(29,30)31/h1-4,7-10H,5-6,11H2,(H,32,35)(H,33,36) |
| InChIKey | MXZWWTUDKLZGOQ-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.21 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|