C22H26ClF3N3O7P — CID 88666664
[[5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-nitrobenzoyl]amino]methyl-octan-4-yloxyphosphinic acid (PubChem CID 88666664) has the molecular formula C22H26ClF3N3O7P and a molecular weight of 567.89 g/mol. Its IUPAC name is [[5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-nitrobenzoyl]amino]methyl-octan-4-yloxyphosphinic acid.
| Compound Name | [[5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-nitrobenzoyl]amino]methyl-octan-4-yloxyphosphinic acid |
|---|---|
| PubChem CID | 88666664 |
| Molecular Formula | C22H26ClF3N3O7P |
| Molecular Weight | 567.89 g/mol |
| Exact Mass | 567.11 |
| IUPAC Name | [[5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-nitrobenzoyl]amino]methyl-octan-4-yloxyphosphinic acid |
| SMILES | CCCCC(CCC)OP(=O)(O)CNC(=O)c1cc(Oc2ncc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H26ClF3N3O7P/c1-3-5-7-15(6-4-2)36-37(33,34)13-28-20(30)17-11-16(8-9-19(17)29(31)32)35-21-18(23)10-14(12-27-21)22(24,25)26/h8-12,15H,3-7,13H2,1-2H3,(H,28,30)(H,33,34) |
| InChIKey | AFINNDQZHFAORD-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 140.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.89 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|