C20H22ClF3N3O7P — CID 88667168
4-amino-1-[5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-nitrophenyl]-4-diethoxyphosphorylbutan-1-one (PubChem CID 88667168) has the molecular formula C20H22ClF3N3O7P and a molecular weight of 539.83 g/mol. Its IUPAC name is 4-amino-1-[5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-nitrophenyl]-4-diethoxyphosphorylbutan-1-one.
| Compound Name | 4-amino-1-[5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-nitrophenyl]-4-diethoxyphosphorylbutan-1-one |
|---|---|
| PubChem CID | 88667168 |
| Molecular Formula | C20H22ClF3N3O7P |
| Molecular Weight | 539.83 g/mol |
| Exact Mass | 539.08 |
| IUPAC Name | 4-amino-1-[5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-nitrophenyl]-4-diethoxyphosphorylbutan-1-one |
| SMILES | CCOP(=O)(OCC)C(N)CCC(=O)c1cc(Oc2ncc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H22ClF3N3O7P/c1-3-32-35(31,33-4-2)18(25)8-7-17(28)14-10-13(5-6-16(14)27(29)30)34-19-15(21)9-12(11-26-19)20(22,23)24/h5-6,9-11,18H,3-4,7-8,25H2,1-2H3 |
| InChIKey | WRCGYWVGILGVQW-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 143.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.83 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|