C24H19ClF3NO6 — CID 54163100
2-phenylmethoxyethyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]acetate (PubChem CID 54163100) has the molecular formula C24H19ClF3NO6 and a molecular weight of 509.86 g/mol. Its IUPAC name is 2-phenylmethoxyethyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]acetate.
| Compound Name | 2-phenylmethoxyethyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]acetate |
|---|---|
| PubChem CID | 54163100 |
| Molecular Formula | C24H19ClF3NO6 |
| Molecular Weight | 509.86 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | 2-phenylmethoxyethyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]acetate |
| SMILES | O=C(Cc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-])OCCOCc1ccccc1 |
| InChI | InChI=1S/C24H19ClF3NO6/c25-20-14-18(24(26,27)28)6-9-22(20)35-19-7-8-21(29(31)32)17(12-19)13-23(30)34-11-10-33-15-16-4-2-1-3-5-16/h1-9,12,14H,10-11,13,15H2 |
| InChIKey | OPUCRDQJHFSDIK-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.86 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|