C19H15ClF3NO6 — CID 154171244
oxan-4-yl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate (PubChem CID 154171244) has the molecular formula C19H15ClF3NO6 and a molecular weight of 445.78 g/mol. Its IUPAC name is oxan-4-yl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate.
| Compound Name | oxan-4-yl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate |
|---|---|
| PubChem CID | 154171244 |
| Molecular Formula | C19H15ClF3NO6 |
| Molecular Weight | 445.78 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | oxan-4-yl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate |
| SMILES | O=C(OC1CCOCC1)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H15ClF3NO6/c20-15-9-11(19(21,22)23)1-4-17(15)29-13-2-3-16(24(26)27)14(10-13)18(25)30-12-5-7-28-8-6-12/h1-4,9-10,12H,5-8H2 |
| InChIKey | RQNHHCNYYIUVOG-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.78 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|