C17H13BrClF3NNaO4 — CID 67922697
sodium 2-[2-[2-bromo-5-[2-chloro-4-(trifluoromethyl)phenoxy]anilino]ethoxy]acetate (PubChem CID 67922697) has the molecular formula C17H13BrClF3NNaO4 and a molecular weight of 490.64 g/mol. Its IUPAC name is sodium 2-[2-[2-bromo-5-[2-chloro-4-(trifluoromethyl)phenoxy]anilino]ethoxy]acetate.
| Compound Name | sodium 2-[2-[2-bromo-5-[2-chloro-4-(trifluoromethyl)phenoxy]anilino]ethoxy]acetate |
|---|---|
| PubChem CID | 67922697 |
| Molecular Formula | C17H13BrClF3NNaO4 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 488.96 |
| IUPAC Name | sodium 2-[2-[2-bromo-5-[2-chloro-4-(trifluoromethyl)phenoxy]anilino]ethoxy]acetate |
| SMILES | O=C([O-])COCCNc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1Br.[Na+] |
| InChI | InChI=1S/C17H14BrClF3NO4.Na/c18-12-3-2-11(8-14(12)23-5-6-26-9-16(24)25)27-15-4-1-10(7-13(15)19)17(20,21)22;/h1-4,7-8,23H,5-6,9H2,(H,24,25);/q;+1/p-1 |
| InChIKey | FWECMFXQJDRMER-UHFFFAOYSA-M |
| XLogP | 1.10 |
| TPSA | 70.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|