C18H10ClF3N3O7P-2 — CID 70478566
3-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]-3-phosphonatopentanedinitrile (PubChem CID 70478566) has the molecular formula C18H10ClF3N3O7P-2 and a molecular weight of 503.71 g/mol. Its IUPAC name is 3-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]-3-phosphonatopentanedinitrile.
| Compound Name | 3-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]-3-phosphonatopentanedinitrile |
|---|---|
| PubChem CID | 70478566 |
| Molecular Formula | C18H10ClF3N3O7P-2 |
| Molecular Weight | 503.71 g/mol |
| Exact Mass | 502.99 |
| IUPAC Name | 3-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]-3-phosphonatopentanedinitrile |
| SMILES | N#CCC(CC#N)(Oc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-])P(=O)([O-])[O-] |
| InChI | InChI=1S/C18H12ClF3N3O7P/c19-13-9-11(18(20,21)22)1-4-15(13)31-12-2-3-14(25(26)27)16(10-12)32-17(5-7-23,6-8-24)33(28,29)30/h1-4,9-10H,5-6H2,(H2,28,29,30)/p-2 |
| InChIKey | DHQJJWCBTSHLLD-UHFFFAOYSA-L |
| XLogP | 3.88 |
| TPSA | 172.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.71 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|