C16H10F3N3O5 — CID 57006201
[5-[2-cyano-4-(trifluoromethyl)phenoxy]-2-nitrophenyl] N-methylcarbamate (PubChem CID 57006201) has the molecular formula C16H10F3N3O5 and a molecular weight of 381.27 g/mol. Its IUPAC name is [5-[2-cyano-4-(trifluoromethyl)phenoxy]-2-nitrophenyl] N-methylcarbamate.
| Compound Name | [5-[2-cyano-4-(trifluoromethyl)phenoxy]-2-nitrophenyl] N-methylcarbamate |
|---|---|
| PubChem CID | 57006201 |
| Molecular Formula | C16H10F3N3O5 |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | [5-[2-cyano-4-(trifluoromethyl)phenoxy]-2-nitrophenyl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1cc(Oc2ccc(C(F)(F)F)cc2C#N)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H10F3N3O5/c1-21-15(23)27-14-7-11(3-4-12(14)22(24)25)26-13-5-2-10(16(17,18)19)6-9(13)8-20/h2-7H,1H3,(H,21,23) |
| InChIKey | XMAZQCJKDDHEPP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 114.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|