C22H17ClF3N3O8 — CID 22904769
methyl N-[4-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]-2-cyano-3-oxopentanoyl]-N-methylcarbamate (PubChem CID 22904769) has the molecular formula C22H17ClF3N3O8 and a molecular weight of 543.84 g/mol. Its IUPAC name is methyl N-[4-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]-2-cyano-3-oxopentanoyl]-N-methylcarbamate.
| Compound Name | methyl N-[4-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]-2-cyano-3-oxopentanoyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 22904769 |
| Molecular Formula | C22H17ClF3N3O8 |
| Molecular Weight | 543.84 g/mol |
| Exact Mass | 543.07 |
| IUPAC Name | methyl N-[4-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]-2-cyano-3-oxopentanoyl]-N-methylcarbamate |
| SMILES | COC(=O)N(C)C(=O)C(C#N)C(=O)C(C)Oc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H17ClF3N3O8/c1-11(19(30)14(10-27)20(31)28(2)21(32)35-3)36-18-9-13(5-6-16(18)29(33)34)37-17-7-4-12(8-15(17)23)22(24,25)26/h4-9,11,14H,1-3H3 |
| InChIKey | KAXMGGPBLJQUSD-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 149.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.84 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|