C32H18F6N6O9 — CID 21280062
[2-[2-cyano-4-(trifluoromethyl)phenyl]-3-[2-[2-cyano-4-(trifluoromethyl)phenyl]-3-(methylcarbamoyloxy)-4-nitrophenoxy]-6-nitrophenyl] N-methylcarbamate (PubChem CID 21280062) has the molecular formula C32H18F6N6O9 and a molecular weight of 744.52 g/mol. Its IUPAC name is [2-[2-cyano-4-(trifluoromethyl)phenyl]-3-[2-[2-cyano-4-(trifluoromethyl)phenyl]-3-(methylcarbamoyloxy)-4-nitrophenoxy]-6-nitrophenyl] N-methylcarbamate.
| Compound Name | [2-[2-cyano-4-(trifluoromethyl)phenyl]-3-[2-[2-cyano-4-(trifluoromethyl)phenyl]-3-(methylcarbamoyloxy)-4-nitrophenoxy]-6-nitrophenyl] N-methylcarbamate |
|---|---|
| PubChem CID | 21280062 |
| Molecular Formula | C32H18F6N6O9 |
| Molecular Weight | 744.52 g/mol |
| Exact Mass | 744.10 |
| IUPAC Name | [2-[2-cyano-4-(trifluoromethyl)phenyl]-3-[2-[2-cyano-4-(trifluoromethyl)phenyl]-3-(methylcarbamoyloxy)-4-nitrophenoxy]-6-nitrophenyl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1c([N+](=O)[O-])ccc(Oc2ccc([N+](=O)[O-])c(OC(=O)NC)c2-c2ccc(C(F)(F)F)cc2C#N)c1-c1ccc(C(F)(F)F)cc1C#N |
| InChI | InChI=1S/C32H18F6N6O9/c1-41-29(45)52-27-21(43(47)48)7-9-23(25(27)19-5-3-17(31(33,34)35)11-15(19)13-39)51-24-10-8-22(44(49)50)28(53-30(46)42-2)26(24)20-6-4-18(32(36,37)38)12-16(20)14-40/h3-12H,1-2H3,(H,41,45)(H,42,46) |
| InChIKey | VCPXEHVZQLHUJU-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 219.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.52 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|