C32H20Cl2F6N2O11 — CID 21280017
2-[3-[3-(1-carboxyethoxy)-2-[2-chloro-4-(trifluoromethyl)phenyl]-4-nitrophenoxy]-2-[2-chloro-4-(trifluoromethyl)phenyl]-6-nitrophenoxy]propanoic acid (PubChem CID 21280017) has the molecular formula C32H20Cl2F6N2O11 and a molecular weight of 793.41 g/mol. Its IUPAC name is 2-[3-[3-(1-carboxyethoxy)-2-[2-chloro-4-(trifluoromethyl)phenyl]-4-nitrophenoxy]-2-[2-chloro-4-(trifluoromethyl)phenyl]-6-nitrophenoxy]propanoic acid.
| Compound Name | 2-[3-[3-(1-carboxyethoxy)-2-[2-chloro-4-(trifluoromethyl)phenyl]-4-nitrophenoxy]-2-[2-chloro-4-(trifluoromethyl)phenyl]-6-nitrophenoxy]propanoic acid |
|---|---|
| PubChem CID | 21280017 |
| Molecular Formula | C32H20Cl2F6N2O11 |
| Molecular Weight | 793.41 g/mol |
| Exact Mass | 792.03 |
| IUPAC Name | 2-[3-[3-(1-carboxyethoxy)-2-[2-chloro-4-(trifluoromethyl)phenyl]-4-nitrophenoxy]-2-[2-chloro-4-(trifluoromethyl)phenyl]-6-nitrophenoxy]propanoic acid |
| SMILES | CC(Oc1c([N+](=O)[O-])ccc(Oc2ccc([N+](=O)[O-])c(OC(C)C(=O)O)c2-c2ccc(C(F)(F)F)cc2Cl)c1-c1ccc(C(F)(F)F)cc1Cl)C(=O)O |
| InChI | InChI=1S/C32H20Cl2F6N2O11/c1-13(29(43)44)51-27-21(41(47)48)7-9-23(25(27)17-5-3-15(11-19(17)33)31(35,36)37)53-24-10-8-22(42(49)50)28(52-14(2)30(45)46)26(24)18-6-4-16(12-20(18)34)32(38,39)40/h3-14H,1-2H3,(H,43,44)(H,45,46) |
| InChIKey | OOWOSPKMNDJBQL-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 188.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.41 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|