C14H8Cl2F3NO4 — CID 126123923
[3,5-dichloro-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methanol (PubChem CID 126123923) has the molecular formula C14H8Cl2F3NO4 and a molecular weight of 382.12 g/mol. Its IUPAC name is [3,5-dichloro-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methanol.
| Compound Name | [3,5-dichloro-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methanol |
|---|---|
| PubChem CID | 126123923 |
| Molecular Formula | C14H8Cl2F3NO4 |
| Molecular Weight | 382.12 g/mol |
| Exact Mass | 380.98 |
| IUPAC Name | [3,5-dichloro-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methanol |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1Oc1c(Cl)cc(Cl)cc1CO |
| InChI | InChI=1S/C14H8Cl2F3NO4/c15-9-3-7(6-21)13(10(16)5-9)24-12-2-1-8(14(17,18)19)4-11(12)20(22)23/h1-5,21H,6H2 |
| InChIKey | OFBVUUQOCVLSAT-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.12 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|