C34H28Cl2F6N2O5 — CID 21280080
3-butyl-1-[3-butyl-2-[2-chloro-4-(trifluoromethyl)phenyl]-4-nitrophenoxy]-2-[2-chloro-4-(trifluoromethyl)phenyl]-4-nitrobenzene (PubChem CID 21280080) has the molecular formula C34H28Cl2F6N2O5 and a molecular weight of 729.50 g/mol. Its IUPAC name is 3-butyl-1-[3-butyl-2-[2-chloro-4-(trifluoromethyl)phenyl]-4-nitrophenoxy]-2-[2-chloro-4-(trifluoromethyl)phenyl]-4-nitrobenzene.
| Compound Name | 3-butyl-1-[3-butyl-2-[2-chloro-4-(trifluoromethyl)phenyl]-4-nitrophenoxy]-2-[2-chloro-4-(trifluoromethyl)phenyl]-4-nitrobenzene |
|---|---|
| PubChem CID | 21280080 |
| Molecular Formula | C34H28Cl2F6N2O5 |
| Molecular Weight | 729.50 g/mol |
| Exact Mass | 728.13 |
| IUPAC Name | 3-butyl-1-[3-butyl-2-[2-chloro-4-(trifluoromethyl)phenyl]-4-nitrophenoxy]-2-[2-chloro-4-(trifluoromethyl)phenyl]-4-nitrobenzene |
| SMILES | CCCCc1c([N+](=O)[O-])ccc(Oc2ccc([N+](=O)[O-])c(CCCC)c2-c2ccc(C(F)(F)F)cc2Cl)c1-c1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C34H28Cl2F6N2O5/c1-3-5-7-23-27(43(45)46)13-15-29(31(23)21-11-9-19(17-25(21)35)33(37,38)39)49-30-16-14-28(44(47)48)24(8-6-4-2)32(30)22-12-10-20(18-26(22)36)34(40,41)42/h9-18H,3-8H2,1-2H3 |
| InChIKey | DFJDXLASEIJFHH-UHFFFAOYSA-N |
| XLogP | 12.66 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.50 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|