C32H14Cl4F6N2O11 — CID 19087554
(2-chloro-2-oxoethyl) 3-[3-(2-chloro-2-oxoethoxy)carbonyl-2-[2-chloro-4-(trifluoromethyl)phenyl]-4-nitrophenoxy]-2-[2-chloro-4-(trifluoromethyl)phenyl]-6-nitrobenzoate (PubChem CID 19087554) has the molecular formula C32H14Cl4F6N2O11 and a molecular weight of 858.27 g/mol. Its IUPAC name is (2-chloro-2-oxoethyl) 3-[3-(2-chloro-2-oxoethoxy)carbonyl-2-[2-chloro-4-(trifluoromethyl)phenyl]-4-nitrophenoxy]-2-[2-chloro-4-(trifluoromethyl)phenyl]-6-nitrobenzoate.
| Compound Name | (2-chloro-2-oxoethyl) 3-[3-(2-chloro-2-oxoethoxy)carbonyl-2-[2-chloro-4-(trifluoromethyl)phenyl]-4-nitrophenoxy]-2-[2-chloro-4-(trifluoromethyl)phenyl]-6-nitrobenzoate |
|---|---|
| PubChem CID | 19087554 |
| Molecular Formula | C32H14Cl4F6N2O11 |
| Molecular Weight | 858.27 g/mol |
| Exact Mass | 855.93 |
| IUPAC Name | (2-chloro-2-oxoethyl) 3-[3-(2-chloro-2-oxoethoxy)carbonyl-2-[2-chloro-4-(trifluoromethyl)phenyl]-4-nitrophenoxy]-2-[2-chloro-4-(trifluoromethyl)phenyl]-6-nitrobenzoate |
| SMILES | O=C(Cl)COC(=O)c1c([N+](=O)[O-])ccc(Oc2ccc([N+](=O)[O-])c(C(=O)OCC(=O)Cl)c2-c2ccc(C(F)(F)F)cc2Cl)c1-c1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C32H14Cl4F6N2O11/c33-17-9-13(31(37,38)39)1-3-15(17)25-21(7-5-19(43(49)50)27(25)29(47)53-11-23(35)45)55-22-8-6-20(44(51)52)28(30(48)54-12-24(36)46)26(22)16-4-2-14(10-18(16)34)32(40,41)42/h1-10H,11-12H2 |
| InChIKey | SQTWFDHYDQOZBW-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 182.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.27 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|