C16H12ClF3N2O6S — CID 67854931
5-[2-chloro-4-(2,2,2-trifluoroethyl)phenoxy]-N-methylsulfonyl-2-nitrobenzamide (PubChem CID 67854931) has the molecular formula C16H12ClF3N2O6S and a molecular weight of 452.79 g/mol. Its IUPAC name is 5-[2-chloro-4-(2,2,2-trifluoroethyl)phenoxy]-N-methylsulfonyl-2-nitrobenzamide.
| Compound Name | 5-[2-chloro-4-(2,2,2-trifluoroethyl)phenoxy]-N-methylsulfonyl-2-nitrobenzamide |
|---|---|
| PubChem CID | 67854931 |
| Molecular Formula | C16H12ClF3N2O6S |
| Molecular Weight | 452.79 g/mol |
| Exact Mass | 452.01 |
| IUPAC Name | 5-[2-chloro-4-(2,2,2-trifluoroethyl)phenoxy]-N-methylsulfonyl-2-nitrobenzamide |
| SMILES | CS(=O)(=O)NC(=O)c1cc(Oc2ccc(CC(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H12ClF3N2O6S/c1-29(26,27)21-15(23)11-7-10(3-4-13(11)22(24)25)28-14-5-2-9(6-12(14)17)8-16(18,19)20/h2-7H,8H2,1H3,(H,21,23) |
| InChIKey | PBVYCJGXAOWSRC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.79 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|