C17H16ClN3O6 — CID 54548495
2-(carbamoylamino)-2-[(3-chloro-4-nitrophenyl)methyl]-3-phenoxypropanoic acid (PubChem CID 54548495) has the molecular formula C17H16ClN3O6 and a molecular weight of 393.78 g/mol. Its IUPAC name is 2-(carbamoylamino)-2-[(3-chloro-4-nitrophenyl)methyl]-3-phenoxypropanoic acid.
| Compound Name | 2-(carbamoylamino)-2-[(3-chloro-4-nitrophenyl)methyl]-3-phenoxypropanoic acid |
|---|---|
| PubChem CID | 54548495 |
| Molecular Formula | C17H16ClN3O6 |
| Molecular Weight | 393.78 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 2-(carbamoylamino)-2-[(3-chloro-4-nitrophenyl)methyl]-3-phenoxypropanoic acid |
| SMILES | NC(=O)NC(COc1ccccc1)(Cc1ccc([N+](=O)[O-])c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C17H16ClN3O6/c18-13-8-11(6-7-14(13)21(25)26)9-17(15(22)23,20-16(19)24)10-27-12-4-2-1-3-5-12/h1-8H,9-10H2,(H,22,23)(H3,19,20,24) |
| InChIKey | ZIGBXLPBGFQDKI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 144.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.78 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|