C15H10Cl2N4O7 — CID 135419524
2-(2,4-dichloro-6-nitrophenoxy)-N-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]acetamide (PubChem CID 135419524) has the molecular formula C15H10Cl2N4O7 and a molecular weight of 429.17 g/mol. Its IUPAC name is 2-(2,4-dichloro-6-nitrophenoxy)-N-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-(2,4-dichloro-6-nitrophenoxy)-N-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135419524 |
| Molecular Formula | C15H10Cl2N4O7 |
| Molecular Weight | 429.17 g/mol |
| Exact Mass | 427.99 |
| IUPAC Name | 2-(2,4-dichloro-6-nitrophenoxy)-N-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]acetamide |
| SMILES | O=C(COc1c(Cl)cc(Cl)cc1[N+](=O)[O-])N/N=C/c1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C15H10Cl2N4O7/c16-9-4-11(17)15(12(5-9)21(26)27)28-7-14(23)19-18-6-8-3-10(20(24)25)1-2-13(8)22/h1-6,22H,7H2,(H,19,23)/b18-6+ |
| InChIKey | GIGZPFCDBSROCE-NGYBGAFCSA-N |
| XLogP | 3.04 |
| TPSA | 157.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.17 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|