C17H14Cl2N4O5 — CID 135560331
N-(2,4-dichlorophenyl)-N'-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]butanediamide (PubChem CID 135560331) has the molecular formula C17H14Cl2N4O5 and a molecular weight of 425.23 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-N'-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]butanediamide.
| Compound Name | N-(2,4-dichlorophenyl)-N'-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]butanediamide |
|---|---|
| PubChem CID | 135560331 |
| Molecular Formula | C17H14Cl2N4O5 |
| Molecular Weight | 425.23 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | N-(2,4-dichlorophenyl)-N'-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]butanediamide |
| SMILES | O=C(CCC(=O)Nc1ccc(Cl)cc1Cl)N/N=C/c1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C17H14Cl2N4O5/c18-11-1-3-14(13(19)8-11)21-16(25)5-6-17(26)22-20-9-10-7-12(23(27)28)2-4-15(10)24/h1-4,7-9,24H,5-6H2,(H,21,25)(H,22,26)/b20-9+ |
| InChIKey | NFQXCGAAKGQHAW-AWQFTUOYSA-N |
| XLogP | 3.48 |
| TPSA | 133.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.23 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|