C17H14Cl2N4O4 — CID 6089933
N-(2,5-dichlorophenyl)-N'-[(Z)-(4-nitrophenyl)methylideneamino]butanediamide (PubChem CID 6089933) has the molecular formula C17H14Cl2N4O4 and a molecular weight of 409.23 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-N'-[(Z)-(4-nitrophenyl)methylideneamino]butanediamide.
| Compound Name | N-(2,5-dichlorophenyl)-N'-[(Z)-(4-nitrophenyl)methylideneamino]butanediamide |
|---|---|
| PubChem CID | 6089933 |
| Molecular Formula | C17H14Cl2N4O4 |
| Molecular Weight | 409.23 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | N-(2,5-dichlorophenyl)-N'-[(Z)-(4-nitrophenyl)methylideneamino]butanediamide |
| SMILES | O=C(CCC(=O)Nc1cc(Cl)ccc1Cl)N/N=C\c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H14Cl2N4O4/c18-12-3-6-14(19)15(9-12)21-16(24)7-8-17(25)22-20-10-11-1-4-13(5-2-11)23(26)27/h1-6,9-10H,7-8H2,(H,21,24)(H,22,25)/b20-10- |
| InChIKey | IYYRCLSRGCHABP-JMIUGGIZSA-N |
| XLogP | 3.77 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.23 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|