C19H15Br2N5O3 — CID 1272021
N-[1-(4-bromophenyl)ethylideneamino]-1-[(3-bromophenyl)methyl]-4-nitropyrazole-3-carboxamide (PubChem CID 1272021) has the molecular formula C19H15Br2N5O3 and a molecular weight of 521.17 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)ethylideneamino]-1-[(3-bromophenyl)methyl]-4-nitropyrazole-3-carboxamide.
| Compound Name | N-[1-(4-bromophenyl)ethylideneamino]-1-[(3-bromophenyl)methyl]-4-nitropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 1272021 |
| Molecular Formula | C19H15Br2N5O3 |
| Molecular Weight | 521.17 g/mol |
| Exact Mass | 518.95 |
| IUPAC Name | N-[1-(4-bromophenyl)ethylideneamino]-1-[(3-bromophenyl)methyl]-4-nitropyrazole-3-carboxamide |
| SMILES | CC(=NNC(=O)c1nn(Cc2cccc(Br)c2)cc1[N+](=O)[O-])c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H15Br2N5O3/c1-12(14-5-7-15(20)8-6-14)22-23-19(27)18-17(26(28)29)11-25(24-18)10-13-3-2-4-16(21)9-13/h2-9,11H,10H2,1H3,(H,23,27) |
| InChIKey | ROPCBORSWVGONW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.17 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|