C17H16Br2N2O4 — CID 135688670
2-(2,6-dibromo-4-methylphenoxy)-N-[(E)-(2-hydroxy-4-methoxyphenyl)methylideneamino]acetamide (PubChem CID 135688670) has the molecular formula C17H16Br2N2O4 and a molecular weight of 472.13 g/mol. Its IUPAC name is 2-(2,6-dibromo-4-methylphenoxy)-N-[(E)-(2-hydroxy-4-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2,6-dibromo-4-methylphenoxy)-N-[(E)-(2-hydroxy-4-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135688670 |
| Molecular Formula | C17H16Br2N2O4 |
| Molecular Weight | 472.13 g/mol |
| Exact Mass | 469.95 |
| IUPAC Name | 2-(2,6-dibromo-4-methylphenoxy)-N-[(E)-(2-hydroxy-4-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(/C=N/NC(=O)COc2c(Br)cc(C)cc2Br)c(O)c1 |
| InChI | InChI=1S/C17H16Br2N2O4/c1-10-5-13(18)17(14(19)6-10)25-9-16(23)21-20-8-11-3-4-12(24-2)7-15(11)22/h3-8,22H,9H2,1-2H3,(H,21,23)/b20-8+ |
| InChIKey | SLBIRKDQTAODIV-DNTJNYDQSA-N |
| XLogP | 3.76 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.13 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|