C18H22N4O4S — CID 154987149
(3-morpholin-4-ylsulfonylphenyl)-[(2E)-2-(1-pyridin-3-ylethylidene)hydrazinyl]methanol (PubChem CID 154987149) has the molecular formula C18H22N4O4S and a molecular weight of 390.47 g/mol. Its IUPAC name is (3-morpholin-4-ylsulfonylphenyl)-[(2E)-2-(1-pyridin-3-ylethylidene)hydrazinyl]methanol.
| Compound Name | (3-morpholin-4-ylsulfonylphenyl)-[(2E)-2-(1-pyridin-3-ylethylidene)hydrazinyl]methanol |
|---|---|
| PubChem CID | 154987149 |
| Molecular Formula | C18H22N4O4S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | (3-morpholin-4-ylsulfonylphenyl)-[(2E)-2-(1-pyridin-3-ylethylidene)hydrazinyl]methanol |
| SMILES | C/C(=N\NC(O)c1cccc(S(=O)(=O)N2CCOCC2)c1)c1cccnc1 |
| InChI | InChI=1S/C18H22N4O4S/c1-14(16-5-3-7-19-13-16)20-21-18(23)15-4-2-6-17(12-15)27(24,25)22-8-10-26-11-9-22/h2-7,12-13,18,21,23H,8-11H2,1H3/b20-14+ |
| InChIKey | BNZXFEOPXIPMLY-XSFVSMFZSA-N |
| XLogP | 1.11 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|