C14H16N2O6S3 — CID 22110261
N-(2-hydroxy-5-morpholin-4-ylsulfonylphenyl)thiophene-2-sulfonamide (PubChem CID 22110261) has the molecular formula C14H16N2O6S3 and a molecular weight of 404.49 g/mol. Its IUPAC name is N-(2-hydroxy-5-morpholin-4-ylsulfonylphenyl)thiophene-2-sulfonamide.
| Compound Name | N-(2-hydroxy-5-morpholin-4-ylsulfonylphenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 22110261 |
| Molecular Formula | C14H16N2O6S3 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | N-(2-hydroxy-5-morpholin-4-ylsulfonylphenyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(S(=O)(=O)N2CCOCC2)ccc1O)c1cccs1 |
| InChI | InChI=1S/C14H16N2O6S3/c17-13-4-3-11(25(20,21)16-5-7-22-8-6-16)10-12(13)15-24(18,19)14-2-1-9-23-14/h1-4,9-10,15,17H,5-8H2 |
| InChIKey | HIRPOBRSUHXFMF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|